CAS 45159-25-9 appears in our catalog under these names: H-Ala-D-Glu-NH2, H–Ala–D–Glu–NH₂, Alanyl-D-isoglutamine. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1g, 0,1g, Get quote.
(4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid (CAS 45159-25-9) is a chemical compound with the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. IUPAC name: (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid. InChIKey: NKUHWWPUOXOIIR-CRCLSJGQSA-N.
| Molecular formula | C8H15N3O4 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid |
| InChIKey | NKUHWWPUOXOIIR-CRCLSJGQSA-N |
| SMILES | C[C@@H](C(=O)N[C@H](CCC(=O)O)C(=O)N)N |
Computed by PubChem (NCBI)