CAS 656221-79-3 appears in our catalog under these names: Alanyl Glutamine Impurity 20, D-alanyl-D-Glutamine. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-5-amino-2-[[(2R)-2-aminopropanoyl]amino]-5-oxopentanoic acid (CAS 656221-79-3) is a chemical compound with the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. IUPAC name: (2R)-5-amino-2-[[(2R)-2-aminopropanoyl]amino]-5-oxopentanoic acid. InChIKey: HJCMDXDYPOUFDY-RFZPGFLSSA-N.
| Molecular formula | C8H15N3O4 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | (2R)-5-amino-2-[[(2R)-2-aminopropanoyl]amino]-5-oxopentanoic acid |
| InChIKey | HJCMDXDYPOUFDY-RFZPGFLSSA-N |
| SMILES | C[C@H](C(=O)N[C@H](CCC(=O)N)C(=O)O)N |
Computed by PubChem (NCBI)