CAS 100047-94-7 is the registry number for Gly–Gly–Ala–Ome·HCl. Offered by: GLPBio. Available pack sizes: 25g, 5g.
Methyl (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate (CAS 100047-94-7) is a chemical compound with the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. IUPAC name: methyl (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate. InChIKey: ZCRRYFHHDCGFOL-YFKPBYRVSA-N.
| Molecular formula | C8H15N3O4 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | methyl (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoate |
| InChIKey | ZCRRYFHHDCGFOL-YFKPBYRVSA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)CNC(=O)CN |
Computed by PubChem (NCBI)