cas: 87701-68-6 — see every product listed under this CAS number, including other names
Alismoxide 98% (CAS 87701-68-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A301961-1mg |
| cas | 87701-68-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 320.31 Pln | |
| Ambeed | 5mg | 375.94 Pln | |
| Ambeed | 10mg | 531.69 Pln | |
| Ambeed | 25mg | 882.12 Pln | |
| Ambeed | 50mg | 1449.50 Pln | |
| Ambeed | 100mg | 2406.25 Pln | |
| Ambeed | 250mg | 4503.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A301961 |
(1S,3aR,4R,8aS)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol (CAS 87701-68-6) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: (1S,3aR,4R,8aS)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol. InChIKey: IWQURBSTAIRNAE-BARDWOONSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | (1S,3aR,4R,8aS)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol |
| InChIKey | IWQURBSTAIRNAE-BARDWOONSA-N |
| SMILES | CC(C)C1=C[C@H]2[C@@H](CC[C@]2(C)O)[C@](CC1)(C)O |
Computed by PubChem (NCBI)