CAS 915301-61-0 is the registry number for Xanthorrhizol Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]cyclohex-3-ene-1,2-diol (CAS 915301-61-0) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: 2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]cyclohex-3-ene-1,2-diol. InChIKey: YRFJMOGROZTYPC-AUXXQLBISA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | 2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]cyclohex-3-ene-1,2-diol |
| InChIKey | YRFJMOGROZTYPC-AUXXQLBISA-N |
| SMILES | C[C@H](CCC=C(C)C)C1CC(C(C=C1)(C)O)O |
Computed by PubChem (NCBI)