Products 915301-61-0

CAS 915301-61-0 is the registry number for Xanthorrhizol Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]cyclohex-3-ene-1,2-diol (CAS 915301-61-0) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: 2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]cyclohex-3-ene-1,2-diol. InChIKey: YRFJMOGROZTYPC-AUXXQLBISA-N.

Identity
Molecular formulaC15H26O2
Molecular weight238.37 g/mol
IUPAC name2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]cyclohex-3-ene-1,2-diol
InChIKeyYRFJMOGROZTYPC-AUXXQLBISA-N
SMILESC[C@H](CCC=C(C)C)C1CC(C(C=C1)(C)O)O

Computed by PubChem (NCBI)