CAS 26184-88-3 appears in our catalog under these names: Bisabolol Oxide B, >95% (HPLC), Bisabolol oxide B. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 1mg, 5mg, 10mg, 50mg.
2-[(2S,5S)-5-methyl-5-[(1S)-4-methylcyclohex-3-en-1-yl]oxolan-2-yl]propan-2-ol (CAS 26184-88-3) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: 2-[(2S,5S)-5-methyl-5-[(1S)-4-methylcyclohex-3-en-1-yl]oxolan-2-yl]propan-2-ol. InChIKey: RKBAYVATPNYHLW-IPYPFGDCSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | 2-[(2S,5S)-5-methyl-5-[(1S)-4-methylcyclohex-3-en-1-yl]oxolan-2-yl]propan-2-ol |
| InChIKey | RKBAYVATPNYHLW-IPYPFGDCSA-N |
| SMILES | CC1=CC[C@H](CC1)[C@@]2(CC[C@H](O2)C(C)(C)O)C |
Computed by PubChem (NCBI)