CAS 87701-68-6 appears in our catalog under these names: Alismoxide, 95%, Alismoxide, Alismoxide/ 99.98% (existing batch purity), Alismoxide 98%, 1,4-Azulenediol, 1,2,3,3a,4,5,6,8a-octahydro-1,4-dimethyl-7-(1-methylethyl)-, (1S,3aR,4R,8aS)-, 98%, 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 100mg, 20mg, 2mg, 5mg, 10mg, 25mg, 50mg, 1mg.
(1S,3aR,4R,8aS)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol (CAS 87701-68-6) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: (1S,3aR,4R,8aS)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol. InChIKey: IWQURBSTAIRNAE-BARDWOONSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | (1S,3aR,4R,8aS)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol |
| InChIKey | IWQURBSTAIRNAE-BARDWOONSA-N |
| SMILES | CC(C)C1=C[C@H]2[C@@H](CC[C@]2(C)O)[C@](CC1)(C)O |
Computed by PubChem (NCBI)