CAS 84976-67-0 appears in our catalog under these names: trans-4'-Ethyl-(1,1'-bicyclohexyl)-4-carboxylic acid, 97%, Trans–4–Ethyl–(1,1–Bicyclohexyl)–4–Carboxylic Acid, trans,trans-4'-Ethylbicyclohexyl-4-carboxylic Acid, >98.0%(GC)(T), trans-4'-Ethyl-(1,1'-bicyclohexyl)-4-carboxylic acid, 95%, 95%, Trans-4'-ethyl-(1,1'-bicyclohexyl)-4-carboxylic acid, 95%. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 15g, 100g.
4-(4-ethylcyclohexyl)cyclohexane-1-carboxylic acid (CAS 84976-67-0) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylic acid. InChIKey: OQIHEFMTIUJJET-UHFFFAOYSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylic acid |
| InChIKey | OQIHEFMTIUJJET-UHFFFAOYSA-N |
| SMILES | CCC1CCC(CC1)C2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)