cas: 906564-59-8 — see every product listed under this CAS number, including other names
Alkyne NHS ester (hexynoic acid NHS ester), 95% (CAS 906564-59-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Lumiprobe.
| brand | Lumiprobe |
|---|---|
| catalog number | LP-x1720-25mg |
| cas | 906564-59-8 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Lumiprobe | 25mg | 586.78 Pln | |
| Lumiprobe | 50mg | 1049.83 Pln | |
| Lumiprobe | 100mg | 1538.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 2 weeks |
(2,5-dioxopyrrolidin-1-yl) hex-5-ynoate (CAS 906564-59-8) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) hex-5-ynoate. InChIKey: CXSSWEBEHUYETJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) hex-5-ynoate |
| InChIKey | CXSSWEBEHUYETJ-UHFFFAOYSA-N |
| SMILES | C#CCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)