cas: 97148-39-5 — see every product listed under this CAS number, including other names
Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate 98% (CAS 97148-39-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A233025-25g |
| cas | 97148-39-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 320.31 Pln | |
| Ambeed | 100g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A233025 |
Azanium (2Z)-2-(furan-2-yl)-2-methoxyiminoacetate (CAS 97148-39-5) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: azanium (2Z)-2-(furan-2-yl)-2-methoxyiminoacetate. InChIKey: ZWNSXPIVYODLLM-PHZXCRFESA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | azanium (2Z)-2-(furan-2-yl)-2-methoxyiminoacetate |
| InChIKey | ZWNSXPIVYODLLM-PHZXCRFESA-N |
| SMILES | CO/N=C(/C1=CC=CO1)\C(=O)[O-].[NH4+] |
Computed by PubChem (NCBI)