cas: 97148-39-5 — see every product listed under this CAS number, including other names
Ammonium 2-Furyl(methoxyimino)acetate, 98% (CAS 97148-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F068600-1G |
| cas | 97148-39-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 310.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Azanium (2Z)-2-(furan-2-yl)-2-methoxyiminoacetate (CAS 97148-39-5) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: azanium (2Z)-2-(furan-2-yl)-2-methoxyiminoacetate. InChIKey: ZWNSXPIVYODLLM-PHZXCRFESA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | azanium (2Z)-2-(furan-2-yl)-2-methoxyiminoacetate |
| InChIKey | ZWNSXPIVYODLLM-PHZXCRFESA-N |
| SMILES | CO/N=C(/C1=CC=CO1)\C(=O)[O-].[NH4+] |
Computed by PubChem (NCBI)