Products 97148-40-8

CAS 97148-40-8 is the registry number for Cefuroxime Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Azane;(2E)-2-(furan-2-yl)-2-methoxyiminoacetic acid (CAS 97148-40-8) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: azane;(2E)-2-(furan-2-yl)-2-methoxyiminoacetic acid. InChIKey: ZWNSXPIVYODLLM-WVLIHFOGSA-N.

Identity
Molecular formulaC7H10N2O4
Molecular weight186.17 g/mol
IUPAC nameazane;(2E)-2-(furan-2-yl)-2-methoxyiminoacetic acid
InChIKeyZWNSXPIVYODLLM-WVLIHFOGSA-N
SMILESCO/N=C(\C1=CC=CO1)/C(=O)O.N

Computed by PubChem (NCBI)