CAS 97148-40-8 is the registry number for Cefuroxime Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
Azane;(2E)-2-(furan-2-yl)-2-methoxyiminoacetic acid (CAS 97148-40-8) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: azane;(2E)-2-(furan-2-yl)-2-methoxyiminoacetic acid. InChIKey: ZWNSXPIVYODLLM-WVLIHFOGSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | azane;(2E)-2-(furan-2-yl)-2-methoxyiminoacetic acid |
| InChIKey | ZWNSXPIVYODLLM-WVLIHFOGSA-N |
| SMILES | CO/N=C(\C1=CC=CO1)/C(=O)O.N |
Computed by PubChem (NCBI)