cas: 5407-57-8 — see every product listed under this CAS number, including other names
Antimalarial agent 39 95% (CAS 5407-57-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311853-100mg |
| cas | 5407-57-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 459.38 Pln | |
| Ambeed | 5g | 1900.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A311853 |
N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine (CAS 5407-57-8) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine. InChIKey: XBDASFGJHWAFFE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | N'-(7-chloroquinolin-4-yl)ethane-1,2-diamine |
| InChIKey | XBDASFGJHWAFFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Cl)NCCN |
Computed by PubChem (NCBI)