cas: 110954-19-3 — see every product listed under this CAS number, including other names
Aspartyl-alanyl-diketopiperazine 90% (CAS 110954-19-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1493844-25mg |
| cas | 110954-19-3 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 798.69 Pln | |
| Ambeed | 50mg | 1304.88 Pln | |
| Ambeed | 100mg | 2172.62 Pln | |
| Ambeed | 250mg | 4058.31 Pln |
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1493844 |
2-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]acetic acid (CAS 110954-19-3) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: 2-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]acetic acid. InChIKey: RVLCUCVJZVRNDC-IMJSIDKUSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 2-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]acetic acid |
| InChIKey | RVLCUCVJZVRNDC-IMJSIDKUSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)O |
Computed by PubChem (NCBI)