cas: 110954-19-3 — see every product listed under this CAS number, including other names
Aspartyl-alanyl-diketopiperazine, 99% (CAS 110954-19-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1493844-10g |
| cas | 110954-19-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 34768.30 Pln | |
| AmBeed | 1g | 8363.74 Pln | |
| AmBeed | 5g | 24866.59 Pln |
| purity | 99% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]acetic acid (CAS 110954-19-3) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: 2-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]acetic acid. InChIKey: RVLCUCVJZVRNDC-IMJSIDKUSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 2-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]acetic acid |
| InChIKey | RVLCUCVJZVRNDC-IMJSIDKUSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)O |
Computed by PubChem (NCBI)