Products 397847-46-0
CAS 397847-46-0 is the registry number for (Rac)-Aspartyl-alanyl-diketopiperazine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(5-methyl-3,6-dioxopiperazin-2-yl)acetic acid (CAS 397847-46-0) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: 2-(5-methyl-3,6-dioxopiperazin-2-yl)acetic acid. InChIKey: RVLCUCVJZVRNDC-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 2-(5-methyl-3,6-dioxopiperazin-2-yl)acetic acid |
| InChIKey | RVLCUCVJZVRNDC-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC(C(=O)N1)CC(=O)O |
Computed by PubChem (NCBI)