CAS 153420-96-3 appears in our catalog under these names: Atibeprone, Atibeprone/ 99.92% (existing batch purity), 3,4-Dimethyl-7-[[5-(1-methylethyl)-1,3,4-thiadiazol-2-yl]methoxy]-2H-1-benzopyran-2-one. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 50mg, 25 mg, 5 mg.
3,4-dimethyl-7-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one (CAS 153420-96-3) is a chemical compound with the molecular formula C17H18N2O3S and a molecular weight of 330.4 g/mol. IUPAC name: 3,4-dimethyl-7-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one. InChIKey: HQTNJPCZUQAYAB-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 3,4-dimethyl-7-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methoxy]chromen-2-one |
| InChIKey | HQTNJPCZUQAYAB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)OCC3=NN=C(S3)C(C)C)C |
Computed by PubChem (NCBI)