cas: 979-88-4 — see every product listed under this CAS number, including other names
BCA 96% (CAS 979-88-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146947-1mg |
| cas | 979-88-4 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 854.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146947 |
Disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate (CAS 979-88-4) is a chemical compound with the molecular formula C20H10N2Na2O4 and a molecular weight of 388.3 g/mol. IUPAC name: disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate. InChIKey: AUPXFICLXPLHBB-UHFFFAOYSA-L.
| Molecular formula | C20H10N2Na2O4 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate |
| InChIKey | AUPXFICLXPLHBB-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=NC4=CC=CC=C4C(=C3)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)