Products 1675203-84-5
CAS 1675203-84-5 appears in our catalog under these names: BMS–202, BMS-202/ 98.24% (existing batch purity), BMS-202, BMS-202 98%, N-[2-[[[2-Methoxy-6-[(2-methyl[1,1'-biphenyl]-3-yl)methoxy]-3-pyridinyl]methyl]amino]ethyl]acetamide, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso).
N-[2-[[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methylamino]ethyl]acetamide (CAS 1675203-84-5) is a chemical compound with the molecular formula C25H29N3O3 and a molecular weight of 419.5 g/mol. IUPAC name: N-[2-[[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methylamino]ethyl]acetamide. InChIKey: JEDPSOYOYVELLZ-UHFFFAOYSA-N.
| Molecular formula | C25H29N3O3 |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | N-[2-[[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methylamino]ethyl]acetamide |
| InChIKey | JEDPSOYOYVELLZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C2=CC=CC=C2)COC3=NC(=C(C=C3)CNCCNC(=O)C)OC |
Computed by PubChem (NCBI)