Products 1140897-32-0
CAS 1140897-32-0 appears in our catalog under these names: BMS-823778/ 99.39% (existing batch purity), BMS-823778 free base, BMS-823778. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 200mg.
2-[3-[1-(4-chlorophenyl)cyclopropyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol (CAS 1140897-32-0) is a chemical compound with the molecular formula C18H18ClN3O and a molecular weight of 327.8 g/mol. IUPAC name: 2-[3-[1-(4-chlorophenyl)cyclopropyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol. InChIKey: PTIFVLOBVCIMKL-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | 2-[3-[1-(4-chlorophenyl)cyclopropyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol |
| InChIKey | PTIFVLOBVCIMKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CN2C1=NN=C2C3(CC3)C4=CC=C(C=C4)Cl)O |
Computed by PubChem (NCBI)