cas: 500770-75-2 — see every product listed under this CAS number, including other names
BOC-(S)-3-AMINO-3-(2-BROMO-PHENYL)-PROPIONIC ACID, 98%, 98% (CAS 500770-75-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D90B-100mg |
| cas | 500770-75-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 2056.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-(2-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500770-75-2) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: (3S)-3-(2-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JLEZYQLFLYPMMA-NSHDSACASA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | (3S)-3-(2-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JLEZYQLFLYPMMA-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)