CAS 82278-95-3 appears in our catalog under these names: 3-(3-Bromophenyl)-2-[(tert-butoxycarbonyl)amino]propanoic acid, 98%, 3-(3-Bromophenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 98%, N-Boc-3-bromo-DL-phenylalanine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g, 2,5g.
3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 82278-95-3) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: 3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FBUDYESOPLBQIR-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | 3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FBUDYESOPLBQIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)