CAS 787576-32-3 is the registry number for Methyl 2-((4-bromophenyl)(tert-butoxycarbonyl)amino)acetate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 250mg, 1g, 5g.
Methyl 2-[4-bromo-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetate (CAS 787576-32-3) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: methyl 2-[4-bromo-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetate. InChIKey: WYVNWDDWNLKSDL-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | methyl 2-[4-bromo-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]acetate |
| InChIKey | WYVNWDDWNLKSDL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)OC)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)