cas: 261360-71-8 — see every product listed under this CAS number, including other names
BOC-3-METHOXY-L-PHENYLALANINE, 97% (CAS 261360-71-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F514150-1G |
| cas | 261360-71-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 1575.50 Pln | |
| Fluorochem | 25g | 5074.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-3-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 261360-71-8) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: (2S)-3-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GOHDMZILHKRUGN-LBPRGKRZSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | (2S)-3-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GOHDMZILHKRUGN-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)OC)C(=O)O |
Computed by PubChem (NCBI)