Products 1374457-01-8
CAS 1374457-01-8 is the registry number for 2,6-Diethyl-1-oxy-pyridine-3,5-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Diethyl 2,6-diethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate (CAS 1374457-01-8) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: diethyl 2,6-diethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate. InChIKey: BYJSUAJCLZASNP-UHFFFAOYSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | diethyl 2,6-diethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate |
| InChIKey | BYJSUAJCLZASNP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C(=[N+]1[O-])CC)C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)