CAS 116661-86-0 is the registry number for N-Boc-(2s,3s)-3-amino-2-hydroxy-4-phenyl-butyric acid, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid (CAS 116661-86-0) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: (2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid. InChIKey: BHTRKISIDQZUQX-RYUDHWBXSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | (2S,3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid |
| InChIKey | BHTRKISIDQZUQX-RYUDHWBXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)