CAS 876755-01-0 is the registry number for (R)-{[(tert-Butoxy)carbonyl]amino}(4-ethoxyphenyl)acetic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 876755-01-0) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: (2R)-2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: BEDGGMAQIUFUCP-GFCCVEGCSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | (2R)-2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | BEDGGMAQIUFUCP-GFCCVEGCSA-N |
| SMILES | CCOC1=CC=C(C=C1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)