CAS 193073-85-7 is the registry number for Methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-2-(4-methoxyphenyl)acetate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2R)-2-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 193073-85-7) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl (2R)-2-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: TZOXSNVVHRMKHH-GFCCVEGCSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | methyl (2R)-2-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | TZOXSNVVHRMKHH-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC=C(C=C1)OC)C(=O)OC |
Computed by PubChem (NCBI)