CAS 1550053-19-4 appears in our catalog under these names: BRD4097/ 99.08% (existing batch purity), BRD4097. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
4-acetamido-N-(2-amino-4-methylphenyl)benzamide (CAS 1550053-19-4) is a chemical compound with the molecular formula C16H17N3O2 and a molecular weight of 283.32 g/mol. IUPAC name: 4-acetamido-N-(2-amino-4-methylphenyl)benzamide. InChIKey: HRMBUIZWNJTBSE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 4-acetamido-N-(2-amino-4-methylphenyl)benzamide |
| InChIKey | HRMBUIZWNJTBSE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC=C(C=C2)NC(=O)C)N |
Computed by PubChem (NCBI)