cas: 1440209-96-0 — see every product listed under this CAS number, including other names
BRD73954, 99%, 99% (CAS 1440209-96-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQC2-5mg |
| cas | 1440209-96-0 |
| size | 5mg |
| availability | 2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 107.60 Pln | |
| Chemat | 10mg | 117.20 Pln | |
| Chemat | 25mg | 131.60 Pln | |
| Chemat | 50mg | 174.80 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 789.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide (CAS 1440209-96-0) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: 3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide. InChIKey: FIHKWEQJEDRIFS-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide |
| InChIKey | FIHKWEQJEDRIFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=O)C2=CC(=CC=C2)C(=O)NO |
Computed by PubChem (NCBI)