CAS 125515-95-9 is the registry number for Z-DL-Phg-NH2, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Benzyl N-(2-amino-2-oxo-1-phenylethyl)carbamate (CAS 125515-95-9) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: benzyl N-(2-amino-2-oxo-1-phenylethyl)carbamate. InChIKey: NTKPNKLUBASDQB-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | benzyl N-(2-amino-2-oxo-1-phenylethyl)carbamate |
| InChIKey | NTKPNKLUBASDQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)