Products 1713588-31-8

CAS 1713588-31-8 is the registry number for 2-Benzyl-3-oxo-2,3,5,6,7,8-hexahydro-cinnoline-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-benzyl-3-oxo-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid (CAS 1713588-31-8) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: 2-benzyl-3-oxo-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid. InChIKey: FACMVMGAETUGIL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16N2O3
Molecular weight284.31 g/mol
IUPAC name2-benzyl-3-oxo-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid
InChIKeyFACMVMGAETUGIL-UHFFFAOYSA-N
SMILESC1CC2=NN(C(=O)C=C2CC1C(=O)O)CC3=CC=CC=C3

Computed by PubChem (NCBI)