CAS 1283067-97-9 is the registry number for 2-Isopropyl-9-methyl-1-oxo-2,9-dihydro-1h-beta-carboline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
9-methyl-1-oxo-2-propan-2-ylpyrido[3,4-b]indole-4-carboxylic acid (CAS 1283067-97-9) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: 9-methyl-1-oxo-2-propan-2-ylpyrido[3,4-b]indole-4-carboxylic acid. InChIKey: LWGZUIBSXHZGCD-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 9-methyl-1-oxo-2-propan-2-ylpyrido[3,4-b]indole-4-carboxylic acid |
| InChIKey | LWGZUIBSXHZGCD-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C2=C(C1=O)N(C3=CC=CC=C32)C)C(=O)O |
Computed by PubChem (NCBI)