CAS 58690-81-6 appears in our catalog under these names: Bz-tyr-nh2, 95%, Bz-L-Tyr-NH2, Benzoyl-L-tyrosine amide. Offered by: Combi-blocks, Iris Biotech, Biosynth. Available pack sizes: 25g, 1g, 5g.
N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]benzamide (CAS 58690-81-6) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]benzamide. InChIKey: QYBPBEKJXBRSGI-AWEZNQCLSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]benzamide |
| InChIKey | QYBPBEKJXBRSGI-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N |
Computed by PubChem (NCBI)