CAS 205437-64-5 appears in our catalog under these names: BU 224 hydrochloride, BU 224 hydrochloride/ 99.2% (existing batch purity), Bu 224 hydrochloride, 2-(4,5-Dihydro-1H-imidazol-2-yl)quinoline hydrochloride, 95%+, 95%+, BU224 (hydrochloride), 96.96%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-(4,5-dihydro-1H-imidazol-2-yl)quinoline;hydrochloride (CAS 205437-64-5) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 2-(4,5-dihydro-1H-imidazol-2-yl)quinoline;hydrochloride. InChIKey: DDFHQXAQWZWRSQ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 2-(4,5-dihydro-1H-imidazol-2-yl)quinoline;hydrochloride |
| InChIKey | DDFHQXAQWZWRSQ-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2=NC3=CC=CC=C3C=C2.Cl |
Computed by PubChem (NCBI)