CAS 850717-64-5 appears in our catalog under these names: BX517(PDK1 inhibitor2), BX517/ 99.07% (existing batch purity), PDK1 Inhibitor II, BX-517, BX517, 98.0%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 100 mg.
[(3Z)-2-oxo-3-[1-(1H-pyrrol-2-yl)ethylidene]-1H-indol-5-yl]urea (CAS 850717-64-5) is a chemical compound with the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. IUPAC name: [(3Z)-2-oxo-3-[1-(1H-pyrrol-2-yl)ethylidene]-1H-indol-5-yl]urea. InChIKey: DFURSNCTQGJRRX-JYRVWZFOSA-N.
| Molecular formula | C15H14N4O2 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | [(3Z)-2-oxo-3-[1-(1H-pyrrol-2-yl)ethylidene]-1H-indol-5-yl]urea |
| InChIKey | DFURSNCTQGJRRX-JYRVWZFOSA-N |
| SMILES | C/C(=C/1\C2=C(C=CC(=C2)NC(=O)N)NC1=O)/C3=CC=CN3 |
Computed by PubChem (NCBI)