CAS 1104546-89-5 appears in our catalog under these names: BYK 204165, BYK204165/ 99.61% (existing batch purity), PARP Inhibitor XIV, BYK204165 98%, BYK204165. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 10mg, 50mg, 1mg, 5mg, 25mg, 100mg, 250mg, 10mM/1mL.
(4Z)-4-[(1-methylpyrrol-2-yl)methylidene]isoquinoline-1,3-dione (CAS 1104546-89-5) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: (4Z)-4-[(1-methylpyrrol-2-yl)methylidene]isoquinoline-1,3-dione. InChIKey: BTYSIDSTHDDAJW-LCYFTJDESA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | (4Z)-4-[(1-methylpyrrol-2-yl)methylidene]isoquinoline-1,3-dione |
| InChIKey | BTYSIDSTHDDAJW-LCYFTJDESA-N |
| SMILES | CN1C=CC=C1/C=C\2/C3=CC=CC=C3C(=O)NC2=O |
Computed by PubChem (NCBI)