Benz[cd]indol-2(1H)-one, 95%
cas: 130-00-7 — see every product listed under this CAS number, including other names
Benz[cd]indol-2(1H)-one, 95% (CAS 130-00-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A466724-5g |
| cas | 130-00-7 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 281.38 Pln | |
| Ambeed | 500g | 515.00 Pln | |
| Ambeed | 1kg | 898.81 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 25g | 208.84 Pln | |
| BLDpharm | 100g | 297.70 Pln | |
| BLDpharm | 500g | 503.18 Pln | |
| BLDpharm | 1kg | 886.38 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1H-benzo[cd]indol-2-one (CAS 130-00-7) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 1H-benzo[cd]indol-2-one. InChIKey: GPYLCFQEKPUWLD-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 1H-benzo[cd]indol-2-one |
| InChIKey | GPYLCFQEKPUWLD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)NC3=CC=C2 |
Computed by PubChem (NCBI)