Products 501944-63-4
CAS 501944-63-4 appears in our catalog under these names: 5-(4-Ethynylphenyl)-1,3-oxazole, 95%, 5-(4-Ethynylphenyl)-1,3-oxazole, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 250mg, 1g, 50mg.
5-(4-ethynylphenyl)-1,3-oxazole (CAS 501944-63-4) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 5-(4-ethynylphenyl)-1,3-oxazole. InChIKey: CYRYZDZQFDRTHD-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-(4-ethynylphenyl)-1,3-oxazole |
| InChIKey | CYRYZDZQFDRTHD-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C2=CN=CO2 |
Computed by PubChem (NCBI)