CAS 130200-57-6 appears in our catalog under these names: 6-hydroxy-1-naphthonitrile, 6-Hydroxynaphthalene-1-carbonitrile. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
6-hydroxynaphthalene-1-carbonitrile (CAS 130200-57-6) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 6-hydroxynaphthalene-1-carbonitrile. InChIKey: BSQTUYCOTSTNLF-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 6-hydroxynaphthalene-1-carbonitrile |
| InChIKey | BSQTUYCOTSTNLF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C(=C1)C#N |
Computed by PubChem (NCBI)