CAS 52805-47-7 appears in our catalog under these names: Nafamostat Impurity 15, Nafamostat Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxynaphthalene-1-carbonitrile (CAS 52805-47-7) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 2-hydroxynaphthalene-1-carbonitrile. InChIKey: FQEORPZFSMZRSP-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 2-hydroxynaphthalene-1-carbonitrile |
| InChIKey | FQEORPZFSMZRSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C#N)O |
Computed by PubChem (NCBI)