CAS 1128039-31-5 is the registry number for 3-Ethynylquinolin-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-ethynylquinolin-6-ol (CAS 1128039-31-5) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 3-ethynylquinolin-6-ol. InChIKey: LKZHWVWBXWZYHW-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 3-ethynylquinolin-6-ol |
| InChIKey | LKZHWVWBXWZYHW-UHFFFAOYSA-N |
| SMILES | C#CC1=CN=C2C=CC(=CC2=C1)O |
Computed by PubChem (NCBI)