cas: 588-68-1 — see every product listed under this CAS number, including other names
Benzalazine, 98%, 98% (CAS 588-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O1E-250mg |
| cas | 588-68-1 |
| size | 250mg |
| availability | 624.73g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 25g | 251.60 Pln | |
| Chemat | 50g | 414.80 Pln | |
| Chemat | 100g | 722.00 Pln | |
| Chemat | 250g | 1672.40 Pln | |
| Chemat | 500g | 3278.40 Pln | |
| Chemat | 500mg | 78.80 Pln | |
| Chemat | 10g | 155.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(benzylideneamino)-1-phenylmethanimine (CAS 588-68-1) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: N-(benzylideneamino)-1-phenylmethanimine. InChIKey: CWLGEPSKQDNHIO-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-(benzylideneamino)-1-phenylmethanimine |
| InChIKey | CWLGEPSKQDNHIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NN=CC2=CC=CC=C2 |
Computed by PubChem (NCBI)