Benzalazine, 98.82%
cas: 588-68-1 — see every product listed under this CAS number, including other names
Benzalazine, 98.82% (CAS 588-68-1) is a chemical reagent available from Chemat. Available pack sizes: 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W094747A-5 g |
| cas | 588-68-1 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 240.74 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.82% |
N-(benzylideneamino)-1-phenylmethanimine (CAS 588-68-1) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: N-(benzylideneamino)-1-phenylmethanimine. InChIKey: CWLGEPSKQDNHIO-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-(benzylideneamino)-1-phenylmethanimine |
| InChIKey | CWLGEPSKQDNHIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NN=CC2=CC=CC=C2 |
Computed by PubChem (NCBI)