CAS 1817-74-9 appears in our catalog under these names: 4,4-Dinitrodiphenylmethane, 98%, 4,4'–Dinitrodiphenylmethane, 4,4'-Dinitrodiphenylmethane, >99.0%(GC), Benzene, 1,1'-methylenebis[4-nitro-, 98%(GC),RG. Offered by: Chemat Brand, GLPBio, TCI, Fluorochem. Available pack sizes: on request, 1g, 200mg, 25g, 5g, 100mg, 250mg.
1-nitro-4-[(4-nitrophenyl)methyl]benzene (CAS 1817-74-9) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: 1-nitro-4-[(4-nitrophenyl)methyl]benzene. InChIKey: GLBZQZXDUTUCGK-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1-nitro-4-[(4-nitrophenyl)methyl]benzene |
| InChIKey | GLBZQZXDUTUCGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)