cas: 914635-64-6 — see every product listed under this CAS number, including other names
Benzene, 2-bromo-1-methoxy-3-(trifluoromethyl)-, 97%, 97% (CAS 914635-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGPD-100mg |
| cas | 914635-64-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 500mg | 194.00 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1230.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-methoxy-3-(trifluoromethyl)benzene (CAS 914635-64-6) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 2-bromo-1-methoxy-3-(trifluoromethyl)benzene. InChIKey: PGUOFURUIKCHKC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 2-bromo-1-methoxy-3-(trifluoromethyl)benzene |
| InChIKey | PGUOFURUIKCHKC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)