cas: 914635-64-6 — see every product listed under this CAS number, including other names
2-Bromo-1-methoxy-3-(trifluoromethyl)benzene, 97% (CAS 914635-64-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230923-250MG |
| cas | 914635-64-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1565.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-1-methoxy-3-(trifluoromethyl)benzene (CAS 914635-64-6) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 2-bromo-1-methoxy-3-(trifluoromethyl)benzene. InChIKey: PGUOFURUIKCHKC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 2-bromo-1-methoxy-3-(trifluoromethyl)benzene |
| InChIKey | PGUOFURUIKCHKC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)