cas: 3550-21-8 — see every product listed under this CAS number, including other names
Benzhydryl isothiocyanate, 90% (CAS 3550-21-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | S03388EA |
| cas | 3550-21-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 10g | 251.99 Pln | |
| Thermo Scientific | 25g | 565.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 90% |
[isothiocyanato(phenyl)methyl]benzene (CAS 3550-21-8) is a chemical compound with the molecular formula C14H11NS and a molecular weight of 225.31 g/mol. IUPAC name: [isothiocyanato(phenyl)methyl]benzene. InChIKey: WDOSFTZMBFYTED-UHFFFAOYSA-N.
| Molecular formula | C14H11NS |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | [isothiocyanato(phenyl)methyl]benzene |
| InChIKey | WDOSFTZMBFYTED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)N=C=S |
Computed by PubChem (NCBI)