CAS 10205-58-0 is the registry number for 6-Methyl-2-phenyl-1,3-benzothiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
6-methyl-2-phenyl-1,3-benzothiazole (CAS 10205-58-0) is a chemical compound with the molecular formula C14H11NS and a molecular weight of 225.31 g/mol. IUPAC name: 6-methyl-2-phenyl-1,3-benzothiazole. InChIKey: NNXGMQKTMUWZBW-UHFFFAOYSA-N.
| Molecular formula | C14H11NS |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 6-methyl-2-phenyl-1,3-benzothiazole |
| InChIKey | NNXGMQKTMUWZBW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)