CAS 71215-89-9 is the registry number for 2-Methyl-5-phenylbenzothiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-methyl-5-phenyl-1,3-benzothiazole (CAS 71215-89-9) is a chemical compound with the molecular formula C14H11NS and a molecular weight of 225.31 g/mol. IUPAC name: 2-methyl-5-phenyl-1,3-benzothiazole. InChIKey: KUZZADDAFBFKBN-UHFFFAOYSA-N.
| Molecular formula | C14H11NS |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 2-methyl-5-phenyl-1,3-benzothiazole |
| InChIKey | KUZZADDAFBFKBN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)